C20H26O3 — CID 171762434
methyl 6-(2-hydroxyethyl)-3-phenyladamantane-1-carboxylate (PubChem CID 171762434) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is methyl 6-(2-hydroxyethyl)-3-phenyladamantane-1-carboxylate.
| Compound Name | methyl 6-(2-hydroxyethyl)-3-phenyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 171762434 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl 6-(2-hydroxyethyl)-3-phenyladamantane-1-carboxylate |
| SMILES | COC(=O)C12CC3CC(c4ccccc4)(CC(C1)C3CCO)C2 |
| InChI | InChI=1S/C20H26O3/c1-23-18(22)20-11-14-9-19(13-20,16-5-3-2-4-6-16)10-15(12-20)17(14)7-8-21/h2-6,14-15,17,21H,7-13H2,1H3 |
| InChIKey | SSZQXMCEZGGSBT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |