C25H36N2O — CID 162754679
(7R)-N-(4-aminocyclohexyl)-6-ethyl-3-phenyladamantane-1-carboxamide (PubChem CID 162754679) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is (7R)-N-(4-aminocyclohexyl)-6-ethyl-3-phenyladamantane-1-carboxamide.
| Compound Name | (7R)-N-(4-aminocyclohexyl)-6-ethyl-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 162754679 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | (7R)-N-(4-aminocyclohexyl)-6-ethyl-3-phenyladamantane-1-carboxamide |
| SMILES | CCC1C2CC3(C(=O)NC4CCC(N)CC4)C[C@H]1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C25H36N2O/c1-2-22-17-12-24(19-6-4-3-5-7-19)13-18(22)15-25(14-17,16-24)23(28)27-21-10-8-20(26)9-11-21/h3-7,17-18,20-22H,2,8-16,26H2,1H3,(H,27,28)/t17-,18?,20?,21?,22?,24?,25?/m1/s1 |
| InChIKey | FRRREFPUEDCAIE-LPGDOPTFSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |