C24H34N2O — CID 152871733
N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide (PubChem CID 152871733) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 152871733 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C(=O)NC4CCC(N)CC4)(C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C24H34N2O/c1-22-11-17-12-23(14-22,18-5-3-2-4-6-18)16-24(13-17,15-22)21(27)26-20-9-7-19(25)8-10-20/h2-6,17,19-20H,7-16,25H2,1H3,(H,26,27) |
| InChIKey | TZNRCHUCVIMHIH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |