C25H35FN2O — CID 137436155
(3S,5R)-N-(4-aminocyclohexyl)-3-(2-fluoroethyl)-5-phenyladamantane-1-carboxamide (PubChem CID 137436155) has the molecular formula C25H35FN2O and a molecular weight of 398.57 g/mol. Its IUPAC name is (3S,5R)-N-(4-aminocyclohexyl)-3-(2-fluoroethyl)-5-phenyladamantane-1-carboxamide.
| Compound Name | (3S,5R)-N-(4-aminocyclohexyl)-3-(2-fluoroethyl)-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 137436155 |
| Molecular Formula | C25H35FN2O |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (3S,5R)-N-(4-aminocyclohexyl)-3-(2-fluoroethyl)-5-phenyladamantane-1-carboxamide |
| SMILES | NC1CCC(NC(=O)C23CC4C[C@@](CCF)(C2)C[C@](c2ccccc2)(C4)C3)CC1 |
| InChI | InChI=1S/C25H35FN2O/c26-11-10-23-12-18-13-24(15-23,19-4-2-1-3-5-19)17-25(14-18,16-23)22(29)28-21-8-6-20(27)7-9-21/h1-5,18,20-21H,6-17,27H2,(H,28,29)/t18?,20?,21?,23-,24-,25?/m1/s1 |
| InChIKey | HAOUSVAXPCHKDC-IZPSXBENSA-N |
| XLogP | 4.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |