C26H36N2O — CID 171762331
(3R,5R)-N-(6-aminospiro[3.3]heptan-2-yl)-3-ethyl-5-phenyladamantane-1-carboxamide (PubChem CID 171762331) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is (3R,5R)-N-(6-aminospiro[3.3]heptan-2-yl)-3-ethyl-5-phenyladamantane-1-carboxamide.
| Compound Name | (3R,5R)-N-(6-aminospiro[3.3]heptan-2-yl)-3-ethyl-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 171762331 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (3R,5R)-N-(6-aminospiro[3.3]heptan-2-yl)-3-ethyl-5-phenyladamantane-1-carboxamide |
| SMILES | CC[C@]12CC3CC(C(=O)NC4CC5(CC(N)C5)C4)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C26H36N2O/c1-2-23-8-18-9-25(15-23,19-6-4-3-5-7-19)17-26(10-18,16-23)22(29)28-21-13-24(14-21)11-20(27)12-24/h3-7,18,20-21H,2,8-17,27H2,1H3,(H,28,29)/t18?,20?,21?,23-,24?,25-,26?/m1/s1 |
| InChIKey | UAERIHQRCZDIPK-PTTWMDLUSA-N |
| XLogP | 4.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |