C23H31FN2O — CID 137435864
(3S,5S)-3-(fluoromethyl)-5-phenyl-N-piperidin-4-yladamantane-1-carboxamide (PubChem CID 137435864) has the molecular formula C23H31FN2O and a molecular weight of 370.51 g/mol. Its IUPAC name is (3S,5S)-3-(fluoromethyl)-5-phenyl-N-piperidin-4-yladamantane-1-carboxamide.
| Compound Name | (3S,5S)-3-(fluoromethyl)-5-phenyl-N-piperidin-4-yladamantane-1-carboxamide |
|---|---|
| PubChem CID | 137435864 |
| Molecular Formula | C23H31FN2O |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (3S,5S)-3-(fluoromethyl)-5-phenyl-N-piperidin-4-yladamantane-1-carboxamide |
| SMILES | O=C(NC1CCNCC1)C12CC3C[C@@](CF)(C1)C[C@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H31FN2O/c24-16-21-10-17-11-22(13-21,18-4-2-1-3-5-18)15-23(12-17,14-21)20(27)26-19-6-8-25-9-7-19/h1-5,17,19,25H,6-16H2,(H,26,27)/t17?,21-,22+,23?/m0/s1 |
| InChIKey | QGUVGTUCNLICRZ-AXDYXBQLSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |