C27H39NO2 — CID 175631093
(3S,5R)-3-(ethoxymethyl)-N-(4-methylcyclohexyl)-5-phenyladamantane-1-carboxamide (PubChem CID 175631093) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (3S,5R)-3-(ethoxymethyl)-N-(4-methylcyclohexyl)-5-phenyladamantane-1-carboxamide.
| Compound Name | (3S,5R)-3-(ethoxymethyl)-N-(4-methylcyclohexyl)-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 175631093 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (3S,5R)-3-(ethoxymethyl)-N-(4-methylcyclohexyl)-5-phenyladamantane-1-carboxamide |
| SMILES | CCOC[C@]12CC3CC(C(=O)NC4CCC(C)CC4)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C27H39NO2/c1-3-30-19-25-13-21-14-26(16-25,22-7-5-4-6-8-22)18-27(15-21,17-25)24(29)28-23-11-9-20(2)10-12-23/h4-8,20-21,23H,3,9-19H2,1-2H3,(H,28,29)/t20?,21?,23?,25-,26+,27?/m0/s1 |
| InChIKey | WSULOABPCUTPHF-JVBKUXOSSA-N |
| XLogP | 5.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |