C26H37NO2 — CID 157309682
1-[(3S,5R)-3-(ethoxymethyl)-5-phenyl-1-adamantyl]-2-piperidin-4-ylethanone (PubChem CID 157309682) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 1-[(3S,5R)-3-(ethoxymethyl)-5-phenyl-1-adamantyl]-2-piperidin-4-ylethanone.
| Compound Name | 1-[(3S,5R)-3-(ethoxymethyl)-5-phenyl-1-adamantyl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 157309682 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 1-[(3S,5R)-3-(ethoxymethyl)-5-phenyl-1-adamantyl]-2-piperidin-4-ylethanone |
| SMILES | CCOC[C@]12CC3CC(C(=O)CC4CCNCC4)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C26H37NO2/c1-2-29-19-24-13-21-14-25(16-24,22-6-4-3-5-7-22)18-26(15-21,17-24)23(28)12-20-8-10-27-11-9-20/h3-7,20-21,27H,2,8-19H2,1H3/t21?,24-,25+,26?/m0/s1 |
| InChIKey | UJDPAZHWYICVDW-JCEXOGLZSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |