C26H38N2O — CID 137436159
(5R)-N-(3,3-dimethylpiperidin-4-yl)-3-ethyl-5-phenyladamantane-1-carboxamide (PubChem CID 137436159) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is (5R)-N-(3,3-dimethylpiperidin-4-yl)-3-ethyl-5-phenyladamantane-1-carboxamide.
| Compound Name | (5R)-N-(3,3-dimethylpiperidin-4-yl)-3-ethyl-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 137436159 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | (5R)-N-(3,3-dimethylpiperidin-4-yl)-3-ethyl-5-phenyladamantane-1-carboxamide |
| SMILES | CCC12CC3CC(C(=O)NC4CCNCC4(C)C)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C26H38N2O/c1-4-24-12-19-13-25(15-24,20-8-6-5-7-9-20)17-26(14-19,16-24)22(29)28-21-10-11-27-18-23(21,2)3/h5-9,19,21,27H,4,10-18H2,1-3H3,(H,28,29)/t19?,21?,24?,25-,26?/m1/s1 |
| InChIKey | UGYHWXIZDMJNEK-SYTDRHRASA-N |
| XLogP | 4.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |