About 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen
6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen (PubChem CID 142519943) has the molecular formula C20H29NO
and a molecular weight of 299.46 g/mol. Its IUPAC name is 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen |
| PubChem CID | 142519943 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen |
| SMILES | CCC12CCC3(C(N)=O)CC(C1)CC(c1ccccc1)(C2)C3.[H][H] |
| InChI | InChI=1S/C20H27NO.H2/c1-2-18-8-9-19(17(21)22)11-15(10-18)12-20(13-18,14-19)16-6-4-3-5-7-16;/h3-7,15H,2,8-14H2,1H3,(H2,21,22);1H |
| InChIKey | ISYHDAZUSJZGQN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen?
The IUPAC name of 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen (CID 142519943) is 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen.
What is the SMILES notation for 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen?
The canonical SMILES for 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen is CCC12CCC3(C(N)=O)CC(C1)CC(c1ccccc1)(C2)C3.[H][H].
What is the InChIKey of 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen?
The InChIKey is ISYHDAZUSJZGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO.H2/c1-2-18-8-9-19(17(21)22)11-15(10-18)12-20(13-18,14-19)16-6-4-3-5-7-16;/h3-7,15H,2,8-14H2,1H3,(H2,21,22);1H.
What are the key properties of 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen?
6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen has a molecular weight of 299.46 g/mol, XLogP of 4.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1-phenyltricyclo[4.3.1.13,8]undecane-3-carboxamide;molecular hydrogen is sourced from PubChem (CID 142519943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).