C25H33FN2O — CID 137436065
(3R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-phenyl-5-propyladamantane-1-carboxamide (PubChem CID 137436065) has the molecular formula C25H33FN2O and a molecular weight of 396.55 g/mol. Its IUPAC name is (3R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-phenyl-5-propyladamantane-1-carboxamide.
| Compound Name | (3R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-phenyl-5-propyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 137436065 |
| Molecular Formula | C25H33FN2O |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (3R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-phenyl-5-propyladamantane-1-carboxamide |
| SMILES | CCCC12CC3CC(C(=O)/N=C4\CCNC[C@@H]4F)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C25H33FN2O/c1-2-9-23-11-18-12-24(15-23,19-6-4-3-5-7-19)17-25(13-18,16-23)22(29)28-21-8-10-27-14-20(21)26/h3-7,18,20,27H,2,8-17H2,1H3/b28-21+/t18?,20-,23?,24+,25?/m0/s1 |
| InChIKey | FWUJWILGIMPENS-DOPLJJQBSA-N |
| XLogP | 4.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|