C23H29FN2O — CID 137435995
(3R,5R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-methyl-5-phenyladamantane-1-carboxamide (PubChem CID 137435995) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is (3R,5R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-methyl-5-phenyladamantane-1-carboxamide.
| Compound Name | (3R,5R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-methyl-5-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 137435995 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (3R,5R)-N-[(3S)-3-fluoropiperidin-4-ylidene]-3-methyl-5-phenyladamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)/N=C4\CCNC[C@@H]4F)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H29FN2O/c1-21-9-16-10-22(13-21,17-5-3-2-4-6-17)15-23(11-16,14-21)20(27)26-19-7-8-25-12-18(19)24/h2-6,16,18,25H,7-15H2,1H3/b26-19+/t16?,18-,21+,22+,23?/m0/s1 |
| InChIKey | GFPLPMONPCWBRT-IACRDDCPSA-N |
| XLogP | 4.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|