C18H22O2 — CID 137435972
(3R,5R)-3-methyl-5-phenyladamantane-1-carboxylic acid (PubChem CID 137435972) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (3R,5R)-3-methyl-5-phenyladamantane-1-carboxylic acid.
| Compound Name | (3R,5R)-3-methyl-5-phenyladamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 137435972 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (3R,5R)-3-methyl-5-phenyladamantane-1-carboxylic acid |
| SMILES | C[C@]12CC3CC(C(=O)O)(C1)C[C@@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C18H22O2/c1-16-7-13-8-17(10-16,14-5-3-2-4-6-14)12-18(9-13,11-16)15(19)20/h2-6,13H,7-12H2,1H3,(H,19,20)/t13?,16-,17-,18?/m1/s1 |
| InChIKey | LOOOKAIQHTUJFC-KJFXSAIASA-N |
| XLogP | 4.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |