C24H28O2 — CID 118038366
4-[3-ethyl-5-(4-hydroxyphenyl)-1-adamantyl]phenol (PubChem CID 118038366) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-[3-ethyl-5-(4-hydroxyphenyl)-1-adamantyl]phenol.
| Compound Name | 4-[3-ethyl-5-(4-hydroxyphenyl)-1-adamantyl]phenol |
|---|---|
| PubChem CID | 118038366 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 4-[3-ethyl-5-(4-hydroxyphenyl)-1-adamantyl]phenol |
| SMILES | CCC12CC3CC(c4ccc(O)cc4)(C1)CC(c1ccc(O)cc1)(C3)C2 |
| InChI | InChI=1S/C24H28O2/c1-2-22-11-17-12-23(14-22,18-3-7-20(25)8-4-18)16-24(13-17,15-22)19-5-9-21(26)10-6-19/h3-10,17,25-26H,2,11-16H2,1H3 |
| InChIKey | TZMFZYOEARKSIB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |