C37H50O2 — CID 118338422
2-cyclohexyl-4-[3-(3-cyclohexyl-4-hydroxyphenyl)-5-propyl-1-adamantyl]phenol (PubChem CID 118338422) has the molecular formula C37H50O2 and a molecular weight of 526.81 g/mol. Its IUPAC name is 2-cyclohexyl-4-[3-(3-cyclohexyl-4-hydroxyphenyl)-5-propyl-1-adamantyl]phenol.
| Compound Name | 2-cyclohexyl-4-[3-(3-cyclohexyl-4-hydroxyphenyl)-5-propyl-1-adamantyl]phenol |
|---|---|
| PubChem CID | 118338422 |
| Molecular Formula | C37H50O2 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | 2-cyclohexyl-4-[3-(3-cyclohexyl-4-hydroxyphenyl)-5-propyl-1-adamantyl]phenol |
| SMILES | CCCC12CC3CC(c4ccc(O)c(C5CCCCC5)c4)(C1)CC(c1ccc(O)c(C4CCCCC4)c1)(C3)C2 |
| InChI | InChI=1S/C37H50O2/c1-2-17-35-20-26-21-36(23-35,29-13-15-33(38)31(18-29)27-9-5-3-6-10-27)25-37(22-26,24-35)30-14-16-34(39)32(19-30)28-11-7-4-8-12-28/h13-16,18-19,26-28,38-39H,2-12,17,20-25H2,1H3 |
| InChIKey | XKQQSYACYVSVRQ-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |