C27H34O2 — CID 118338412
4-[3-(4-hydroxy-3-methylphenyl)-5-propyl-1-adamantyl]-2-methylphenol (PubChem CID 118338412) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 4-[3-(4-hydroxy-3-methylphenyl)-5-propyl-1-adamantyl]-2-methylphenol.
| Compound Name | 4-[3-(4-hydroxy-3-methylphenyl)-5-propyl-1-adamantyl]-2-methylphenol |
|---|---|
| PubChem CID | 118338412 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 4-[3-(4-hydroxy-3-methylphenyl)-5-propyl-1-adamantyl]-2-methylphenol |
| SMILES | CCCC12CC3CC(c4ccc(O)c(C)c4)(C1)CC(c1ccc(O)c(C)c1)(C3)C2 |
| InChI | InChI=1S/C27H34O2/c1-4-9-25-12-20-13-26(15-25,21-5-7-23(28)18(2)10-21)17-27(14-20,16-25)22-6-8-24(29)19(3)11-22/h5-8,10-11,20,28-29H,4,9,12-17H2,1-3H3 |
| InChIKey | XNTKATUIRVBXHN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |