C38H34N2O2 — CID 118338465
[4-[3-(4-cyanato-3-phenylphenyl)-5-ethyl-1-adamantyl]-2-phenylphenyl] cyanate (PubChem CID 118338465) has the molecular formula C38H34N2O2 and a molecular weight of 550.70 g/mol. Its IUPAC name is [4-[3-(4-cyanato-3-phenylphenyl)-5-ethyl-1-adamantyl]-2-phenylphenyl] cyanate.
| Compound Name | [4-[3-(4-cyanato-3-phenylphenyl)-5-ethyl-1-adamantyl]-2-phenylphenyl] cyanate |
|---|---|
| PubChem CID | 118338465 |
| Molecular Formula | C38H34N2O2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [4-[3-(4-cyanato-3-phenylphenyl)-5-ethyl-1-adamantyl]-2-phenylphenyl] cyanate |
| SMILES | CCC12CC3CC(c4ccc(OC#N)c(-c5ccccc5)c4)(C1)CC(c1ccc(OC#N)c(-c4ccccc4)c1)(C3)C2 |
| InChI | InChI=1S/C38H34N2O2/c1-2-36-19-27-20-37(22-36,30-13-15-34(41-25-39)32(17-30)28-9-5-3-6-10-28)24-38(21-27,23-36)31-14-16-35(42-26-40)33(18-31)29-11-7-4-8-12-29/h3-18,27H,2,19-24H2,1H3 |
| InChIKey | WQCNPVFCNWUWTE-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|