C27H28N2O2 — CID 118338679
[4-[3-(4-cyanato-3-methylphenyl)-5-methyl-1-adamantyl]-2-methylphenyl] cyanate (PubChem CID 118338679) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [4-[3-(4-cyanato-3-methylphenyl)-5-methyl-1-adamantyl]-2-methylphenyl] cyanate.
| Compound Name | [4-[3-(4-cyanato-3-methylphenyl)-5-methyl-1-adamantyl]-2-methylphenyl] cyanate |
|---|---|
| PubChem CID | 118338679 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [4-[3-(4-cyanato-3-methylphenyl)-5-methyl-1-adamantyl]-2-methylphenyl] cyanate |
| SMILES | Cc1cc(C23CC4CC(C)(C2)CC(c2ccc(OC#N)c(C)c2)(C4)C3)ccc1OC#N |
| InChI | InChI=1S/C27H28N2O2/c1-18-8-21(4-6-23(18)30-16-28)26-11-20-10-25(3,13-26)14-27(12-20,15-26)22-5-7-24(31-17-29)19(2)9-22/h4-9,20H,10-15H2,1-3H3 |
| InChIKey | GUIYHIVIPSYURM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|