About 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane
1-(3,5-diethynylphenyl)-3,5-dimethyladamantane (PubChem CID 173077284) has the molecular formula C44H48
and a molecular weight of 576.87 g/mol. Its IUPAC name is 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane.
Molecular Properties
| Compound Name | 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane |
| PubChem CID | 173077284 |
| Molecular Formula | C44H48 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane |
| SMILES | C#Cc1cc(C#C)cc(C23CC4CC(C)(CC(C)(C4)C2)C3)c1.C#Cc1cc(C#C)cc(C23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/2C22H24/c2*1-5-16-7-17(6-2)9-19(8-16)22-12-18-10-20(3,14-22)13-21(4,11-18)15-22/h2*1-2,7-9,18H,10-15H2,3-4H3 |
| InChIKey | LLMGKRQDSLFTHE-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane?
The IUPAC name of 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane (CID 173077284) is 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane.
What is the SMILES notation for 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane?
The canonical SMILES for 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane is C#Cc1cc(C#C)cc(C23CC4CC(C)(CC(C)(C4)C2)C3)c1.C#Cc1cc(C#C)cc(C23CC4CC(C)(CC(C)(C4)C2)C3)c1.
What is the InChIKey of 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane?
The InChIKey is LLMGKRQDSLFTHE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C22H24/c2*1-5-16-7-17(6-2)9-19(8-16)22-12-18-10-20(3,14-22)13-21(4,11-18)15-22/h2*1-2,7-9,18H,10-15H2,3-4H3.
What are the key properties of 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane?
1-(3,5-diethynylphenyl)-3,5-dimethyladamantane has a molecular weight of 576.87 g/mol, XLogP of 9.79, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane is sourced from PubChem (CID 173077284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).