C44H48 — CID 173077284
1-(3,5-diethynylphenyl)-3,5-dimethyladamantane (PubChem CID 173077284) has the molecular formula C44H48 and a molecular weight of 576.87 g/mol. Its IUPAC name is 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane.
| Compound Name | 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane |
|---|---|
| PubChem CID | 173077284 |
| Molecular Formula | C44H48 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 1-(3,5-diethynylphenyl)-3,5-dimethyladamantane |
| SMILES | C#Cc1cc(C#C)cc(C23CC4CC(C)(CC(C)(C4)C2)C3)c1.C#Cc1cc(C#C)cc(C23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/2C22H24/c2*1-5-16-7-17(6-2)9-19(8-16)22-12-18-10-20(3,14-22)13-21(4,11-18)15-22/h2*1-2,7-9,18H,10-15H2,3-4H3 |
| InChIKey | LLMGKRQDSLFTHE-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|