C60H46 — CID 90830510
1-[3,5-bis(3,5-diethynylphenyl)-1-adamantyl]-3,5-bis(3,5-diethynylphenyl)adamantane (PubChem CID 90830510) has the molecular formula C60H46 and a molecular weight of 767.03 g/mol. Its IUPAC name is 1-[3,5-bis(3,5-diethynylphenyl)-1-adamantyl]-3,5-bis(3,5-diethynylphenyl)adamantane.
| Compound Name | 1-[3,5-bis(3,5-diethynylphenyl)-1-adamantyl]-3,5-bis(3,5-diethynylphenyl)adamantane |
|---|---|
| PubChem CID | 90830510 |
| Molecular Formula | C60H46 |
| Molecular Weight | 767.03 g/mol |
| Exact Mass | 766.36 |
| IUPAC Name | 1-[3,5-bis(3,5-diethynylphenyl)-1-adamantyl]-3,5-bis(3,5-diethynylphenyl)adamantane |
| SMILES | C#Cc1cc(C#C)cc(C23CC4CC(c5cc(C#C)cc(C#C)c5)(C2)CC(C25CC6CC(c7cc(C#C)cc(C#C)c7)(CC(c7cc(C#C)cc(C#C)c7)(C6)C2)C5)(C4)C3)c1 |
| InChI | InChI=1S/C60H46/c1-9-41-17-42(10-2)22-51(21-41)55-29-49-30-56(35-55,52-23-43(11-3)18-44(12-4)24-52)38-59(33-49,37-55)60-34-50-31-57(39-60,53-25-45(13-5)19-46(14-6)26-53)36-58(32-50,40-60)54-27-47(15-7)20-48(16-8)28-54/h1-8,17-28,49-50H,29-40H2 |
| InChIKey | KWSQLSBGOVORRZ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.03 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|