C40H38 — CID 90739523
1-(3,5-diethynylphenyl)-3-[3-(3,5-diethynylphenyl)-1-adamantyl]adamantane (PubChem CID 90739523) has the molecular formula C40H38 and a molecular weight of 518.74 g/mol. Its IUPAC name is 1-(3,5-diethynylphenyl)-3-[3-(3,5-diethynylphenyl)-1-adamantyl]adamantane.
| Compound Name | 1-(3,5-diethynylphenyl)-3-[3-(3,5-diethynylphenyl)-1-adamantyl]adamantane |
|---|---|
| PubChem CID | 90739523 |
| Molecular Formula | C40H38 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 1-(3,5-diethynylphenyl)-3-[3-(3,5-diethynylphenyl)-1-adamantyl]adamantane |
| SMILES | C#Cc1cc(C#C)cc(C23CC4CC(C2)CC(C25CC6CC(CC(c7cc(C#C)cc(C#C)c7)(C6)C2)C5)(C4)C3)c1 |
| InChI | InChI=1S/C40H38/c1-5-27-9-28(6-2)14-35(13-27)37-17-31-11-32(18-37)22-39(21-31,25-37)40-23-33-12-34(24-40)20-38(19-33,26-40)36-15-29(7-3)10-30(8-4)16-36/h1-4,9-10,13-16,31-34H,11-12,17-26H2 |
| InChIKey | LPRBEYDFTWSURC-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|