C44H46 — CID 158327251
7-(3,5-diethynylphenyl)-1-[3-(3,5-diethynylphenyl)-1-adamantyl]-2,2,3,4-tetramethyladamantane (PubChem CID 158327251) has the molecular formula C44H46 and a molecular weight of 574.85 g/mol. Its IUPAC name is 7-(3,5-diethynylphenyl)-1-[3-(3,5-diethynylphenyl)-1-adamantyl]-2,2,3,4-tetramethyladamantane.
| Compound Name | 7-(3,5-diethynylphenyl)-1-[3-(3,5-diethynylphenyl)-1-adamantyl]-2,2,3,4-tetramethyladamantane |
|---|---|
| PubChem CID | 158327251 |
| Molecular Formula | C44H46 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | 7-(3,5-diethynylphenyl)-1-[3-(3,5-diethynylphenyl)-1-adamantyl]-2,2,3,4-tetramethyladamantane |
| SMILES | C#Cc1cc(C#C)cc(C23CC4CC(C2)CC(C25CC6CC(c7cc(C#C)cc(C#C)c7)(CC(C)(C6C)C2(C)C)C5)(C4)C3)c1 |
| InChI | InChI=1S/C44H46/c1-9-30-13-31(10-2)17-37(16-30)41-20-34-15-35(21-41)23-43(22-34,27-41)44-25-36-24-42(28-44,26-40(8,29(36)5)39(44,6)7)38-18-32(11-3)14-33(12-4)19-38/h1-4,13-14,16-19,29,34-36H,15,20-28H2,5-8H3 |
| InChIKey | GPOGLFJSGTXSDD-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|