C28H26K2O4 — CID 69273926
dipotassium;5-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarboxylate (PubChem CID 69273926) has the molecular formula C28H26K2O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is dipotassium;5-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarboxylate.
| Compound Name | dipotassium;5-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 69273926 |
| Molecular Formula | C28H26K2O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | dipotassium;5-[2-[4-(3,5-dimethyl-1-adamantyl)phenyl]ethynyl]benzene-1,3-dicarboxylate |
| SMILES | CC12CC3CC(C)(C1)CC(c1ccc(C#Cc4cc(C(=O)[O-])cc(C(=O)[O-])c4)cc1)(C3)C2.[K+].[K+] |
| InChI | InChI=1S/C28H28O4.2K/c1-26-12-20-13-27(2,15-26)17-28(14-20,16-26)23-7-5-18(6-8-23)3-4-19-9-21(24(29)30)11-22(10-19)25(31)32;;/h5-11,20H,12-17H2,1-2H3,(H,29,30)(H,31,32);;/q;2*+1/p-2 |
| InChIKey | ZKLHBNNFEOGVEM-UHFFFAOYSA-L |
| XLogP | -2.93 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|