C74H66 — CID 91607147
1-[3,4-bis(2-phenylethynyl)phenyl]-3-[4-[3-[3,4-bis(2-phenylethynyl)phenyl]-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane (PubChem CID 91607147) has the molecular formula C74H66 and a molecular weight of 955.34 g/mol. Its IUPAC name is 1-[3,4-bis(2-phenylethynyl)phenyl]-3-[4-[3-[3,4-bis(2-phenylethynyl)phenyl]-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane.
| Compound Name | 1-[3,4-bis(2-phenylethynyl)phenyl]-3-[4-[3-[3,4-bis(2-phenylethynyl)phenyl]-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane |
|---|---|
| PubChem CID | 91607147 |
| Molecular Formula | C74H66 |
| Molecular Weight | 955.34 g/mol |
| Exact Mass | 954.52 |
| IUPAC Name | 1-[3,4-bis(2-phenylethynyl)phenyl]-3-[4-[3-[3,4-bis(2-phenylethynyl)phenyl]-5,7-dimethyl-1-adamantyl]phenyl]-5,7-dimethyladamantane |
| SMILES | CC12CC3(C)CC(c4ccc(C56CC7(C)CC(C)(C5)CC(c5ccc(C#Cc8ccccc8)c(C#Cc8ccccc8)c5)(C7)C6)cc4)(C1)CC(c1ccc(C#Cc4ccccc4)c(C#Cc4ccccc4)c1)(C2)C3 |
| InChI | InChI=1S/C74H66/c1-67-43-68(2)46-71(45-67,53-73(49-67,50-68)65-35-33-59(29-25-55-17-9-5-10-18-55)61(41-65)31-27-57-21-13-7-14-22-57)63-37-39-64(40-38-63)72-47-69(3)44-70(4,48-72)52-74(51-69,54-72)66-36-34-60(30-26-56-19-11-6-12-20-56)62(42-66)32-28-58-23-15-8-16-24-58/h5-24,33-42H,43-54H2,1-4H3 |
| InChIKey | KIMIOSXBDACBAH-UHFFFAOYSA-N |
| XLogP | 16.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.34 |
| LogP ≤ 5 | 16.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|