About methylsulfanylmethane;2-phenylethynylbenzene
methylsulfanylmethane;2-phenylethynylbenzene (PubChem CID 166709013) has the molecular formula C16H16S
and a molecular weight of 240.37 g/mol. Its IUPAC name is methylsulfanylmethane;2-phenylethynylbenzene.
Molecular Properties
| Compound Name | methylsulfanylmethane;2-phenylethynylbenzene |
| PubChem CID | 166709013 |
| Molecular Formula | C16H16S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | methylsulfanylmethane;2-phenylethynylbenzene |
| SMILES | C(#Cc1ccccc1)c1ccccc1.CSC |
| InChI | InChI=1S/C14H10.C2H6S/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-2/h1-10H;1-2H3 |
| InChIKey | AXDMSYUKXCYUDI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanylmethane;2-phenylethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanylmethane;2-phenylethynylbenzene?
The IUPAC name of methylsulfanylmethane;2-phenylethynylbenzene (CID 166709013) is methylsulfanylmethane;2-phenylethynylbenzene.
What is the SMILES notation for methylsulfanylmethane;2-phenylethynylbenzene?
The canonical SMILES for methylsulfanylmethane;2-phenylethynylbenzene is C(#Cc1ccccc1)c1ccccc1.CSC.
What is the InChIKey of methylsulfanylmethane;2-phenylethynylbenzene?
The InChIKey is AXDMSYUKXCYUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C2H6S/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-2/h1-10H;1-2H3.
What are the key properties of methylsulfanylmethane;2-phenylethynylbenzene?
methylsulfanylmethane;2-phenylethynylbenzene has a molecular weight of 240.37 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethane;2-phenylethynylbenzene is sourced from PubChem (CID 166709013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).