C24H10F8 — CID 139058258
1,2,3,4,5,6,7,8-octafluoronaphthalene;2-phenylethynylbenzene (PubChem CID 139058258) has the molecular formula C24H10F8 and a molecular weight of 450.33 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octafluoronaphthalene;2-phenylethynylbenzene.
| Compound Name | 1,2,3,4,5,6,7,8-octafluoronaphthalene;2-phenylethynylbenzene |
|---|---|
| PubChem CID | 139058258 |
| Molecular Formula | C24H10F8 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octafluoronaphthalene;2-phenylethynylbenzene |
| SMILES | C(#Cc1ccccc1)c1ccccc1.Fc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C14H10.C10F8/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12/h1-10H; |
| InChIKey | IRROQYMTHMQSSE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|