C14H7F3 — CID 68772874
1,2,3-trifluoro-4-(2-phenylethynyl)benzene (PubChem CID 68772874) has the molecular formula C14H7F3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-(2-phenylethynyl)benzene.
| Compound Name | 1,2,3-trifluoro-4-(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 68772874 |
| Molecular Formula | C14H7F3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1,2,3-trifluoro-4-(2-phenylethynyl)benzene |
| SMILES | Fc1ccc(C#Cc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C14H7F3/c15-12-9-8-11(13(16)14(12)17)7-6-10-4-2-1-3-5-10/h1-5,8-9H |
| InChIKey | IBBIXSHXHAUXIA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|