About 2-phenylethynylbenzene;dihydrochloride
2-phenylethynylbenzene;dihydrochloride (PubChem CID 174927104) has the molecular formula C14H12Cl2
and a molecular weight of 251.16 g/mol. Its IUPAC name is 2-phenylethynylbenzene;dihydrochloride.
Molecular Properties
| Compound Name | 2-phenylethynylbenzene;dihydrochloride |
| PubChem CID | 174927104 |
| Molecular Formula | C14H12Cl2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-phenylethynylbenzene;dihydrochloride |
| SMILES | C(#Cc1ccccc1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C14H10.2ClH/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h1-10H;2*1H |
| InChIKey | XZQUNIYFJYJEJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethynylbenzene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethynylbenzene;dihydrochloride?
The IUPAC name of 2-phenylethynylbenzene;dihydrochloride (CID 174927104) is 2-phenylethynylbenzene;dihydrochloride.
What is the SMILES notation for 2-phenylethynylbenzene;dihydrochloride?
The canonical SMILES for 2-phenylethynylbenzene;dihydrochloride is C(#Cc1ccccc1)c1ccccc1.Cl.Cl.
What is the InChIKey of 2-phenylethynylbenzene;dihydrochloride?
The InChIKey is XZQUNIYFJYJEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.2ClH/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;/h1-10H;2*1H.
What are the key properties of 2-phenylethynylbenzene;dihydrochloride?
2-phenylethynylbenzene;dihydrochloride has a molecular weight of 251.16 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethynylbenzene;dihydrochloride is sourced from PubChem (CID 174927104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).