C24H10 — CID 102289282
12-phenyl(1,12-13C2)dodeca-1,3,5,7,9,11-hexaynylbenzene (PubChem CID 102289282) has the molecular formula C24H10 and a molecular weight of 300.33 g/mol. Its IUPAC name is 12-phenyl(1,12-13C2)dodeca-1,3,5,7,9,11-hexaynylbenzene.
| Compound Name | 12-phenyl(1,12-13C2)dodeca-1,3,5,7,9,11-hexaynylbenzene |
|---|---|
| PubChem CID | 102289282 |
| Molecular Formula | C24H10 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 12-phenyl(1,12-13C2)dodeca-1,3,5,7,9,11-hexaynylbenzene |
| SMILES | C(C#CC#CC#[13C]c1ccccc1)#CC#CC#[13C]c1ccccc1 |
| InChI | InChI=1S/C24H10/c1(3-5-7-11-17-23-19-13-9-14-20-23)2-4-6-8-12-18-24-21-15-10-16-22-24/h9-10,13-16,19-22H/i17+1,18+1 |
| InChIKey | MLWMBPSCAZWEPG-VJNPICPZSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|