C16H11N — CID 71417965
3-(4-phenylbuta-1,3-diynyl)aniline (PubChem CID 71417965) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(4-phenylbuta-1,3-diynyl)aniline.
| Compound Name | 3-(4-phenylbuta-1,3-diynyl)aniline |
|---|---|
| PubChem CID | 71417965 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(4-phenylbuta-1,3-diynyl)aniline |
| SMILES | Nc1cccc(C#CC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H11N/c17-16-12-6-11-15(13-16)10-5-4-9-14-7-2-1-3-8-14/h1-3,6-8,11-13H,17H2 |
| InChIKey | ZXCJPZATEVLOQN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|