C8H7N — CID 71308909
3-(1,2-13C2)ethynyl(13C2)aniline (PubChem CID 71308909) has the molecular formula C8H7N and a molecular weight of 119.14 g/mol. Its IUPAC name is 3-(1,2-13C2)ethynyl(13C2)aniline.
| Compound Name | 3-(1,2-13C2)ethynyl(13C2)aniline |
|---|---|
| PubChem CID | 71308909 |
| Molecular Formula | C8H7N |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 3-(1,2-13C2)ethynyl(13C2)aniline |
| SMILES | [13CH]#[13C]c1cccc(N)c1 |
| InChI | InChI=1S/C8H7N/c1-2-7-4-3-5-8(9)6-7/h1,3-6H,9H2/i1+1,2+1 |
| InChIKey | NNKQLUVBPJEUOR-ZDOIIHCHSA-N |
| XLogP | 1.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|