C17H9NS — CID 154991805
1-isothiocyanato-4-(4-phenylbuta-1,3-diynyl)benzene (PubChem CID 154991805) has the molecular formula C17H9NS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-isothiocyanato-4-(4-phenylbuta-1,3-diynyl)benzene.
| Compound Name | 1-isothiocyanato-4-(4-phenylbuta-1,3-diynyl)benzene |
|---|---|
| PubChem CID | 154991805 |
| Molecular Formula | C17H9NS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-isothiocyanato-4-(4-phenylbuta-1,3-diynyl)benzene |
| SMILES | S=C=Nc1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H9NS/c19-14-18-17-12-10-16(11-13-17)9-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,10-13H |
| InChIKey | XNEFJOBOSNZWOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|