C18H8N4-2 — CID 102404020
[4-[4-[4-(azanidylidenemethylideneamino)phenyl]buta-1,3-diynyl]phenyl]iminomethylideneazanide (PubChem CID 102404020) has the molecular formula C18H8N4-2 and a molecular weight of 280.29 g/mol. Its IUPAC name is [4-[4-[4-(azanidylidenemethylideneamino)phenyl]buta-1,3-diynyl]phenyl]iminomethylideneazanide.
| Compound Name | [4-[4-[4-(azanidylidenemethylideneamino)phenyl]buta-1,3-diynyl]phenyl]iminomethylideneazanide |
|---|---|
| PubChem CID | 102404020 |
| Molecular Formula | C18H8N4-2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [4-[4-[4-(azanidylidenemethylideneamino)phenyl]buta-1,3-diynyl]phenyl]iminomethylideneazanide |
| SMILES | [N-]=C=Nc1ccc(C#CC#Cc2ccc(N=C=[N-])cc2)cc1 |
| InChI | InChI=1S/C18H8N4/c19-13-21-17-9-5-15(6-10-17)3-1-2-4-16-7-11-18(12-8-16)22-14-20/h5-12H/q-2 |
| InChIKey | YHMSVHMKDOFEAS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|