C17H11F — CID 20700580
1-fluoro-4-[4-(4-methylphenyl)buta-1,3-diynyl]benzene (PubChem CID 20700580) has the molecular formula C17H11F and a molecular weight of 234.27 g/mol. Its IUPAC name is 1-fluoro-4-[4-(4-methylphenyl)buta-1,3-diynyl]benzene.
| Compound Name | 1-fluoro-4-[4-(4-methylphenyl)buta-1,3-diynyl]benzene |
|---|---|
| PubChem CID | 20700580 |
| Molecular Formula | C17H11F |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-fluoro-4-[4-(4-methylphenyl)buta-1,3-diynyl]benzene |
| SMILES | Cc1ccc(C#CC#Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H11F/c1-14-6-8-15(9-7-14)4-2-3-5-16-10-12-17(18)13-11-16/h6-13H,1H3 |
| InChIKey | GFPIZRHLAMJWSP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|