About 1-fluoro-4-methylbenzene;methane
1-fluoro-4-methylbenzene;methane (PubChem CID 158431518) has the molecular formula C8H11F
and a molecular weight of 126.17 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;methane.
Molecular Properties
| Compound Name | 1-fluoro-4-methylbenzene;methane |
| PubChem CID | 158431518 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1-fluoro-4-methylbenzene;methane |
| SMILES | C.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7F.CH4/c1-6-2-4-7(8)5-3-6;/h2-5H,1H3;1H4 |
| InChIKey | HBSDSRXDBJVIIR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-4-methylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methylbenzene;methane?
The IUPAC name of 1-fluoro-4-methylbenzene;methane (CID 158431518) is 1-fluoro-4-methylbenzene;methane.
What is the SMILES notation for 1-fluoro-4-methylbenzene;methane?
The canonical SMILES for 1-fluoro-4-methylbenzene;methane is C.Cc1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-methylbenzene;methane?
The InChIKey is HBSDSRXDBJVIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.CH4/c1-6-2-4-7(8)5-3-6;/h2-5H,1H3;1H4.
What are the key properties of 1-fluoro-4-methylbenzene;methane?
1-fluoro-4-methylbenzene;methane has a molecular weight of 126.17 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methylbenzene;methane is sourced from PubChem (CID 158431518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).