About 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine
1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine (PubChem CID 143556008) has the molecular formula C14H24FN
and a molecular weight of 225.35 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine |
| PubChem CID | 143556008 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine |
| SMILES | CCCN(C)CCC.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C7H7F.C7H17N/c1-6-2-4-7(8)5-3-6;1-4-6-8(3)7-5-2/h2-5H,1H3;4-7H2,1-3H3 |
| InChIKey | WSOHFGMPNKQTMW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine?
The IUPAC name of 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine (CID 143556008) is 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine.
What is the SMILES notation for 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine?
The canonical SMILES for 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine is CCCN(C)CCC.Cc1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine?
The InChIKey is WSOHFGMPNKQTMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C7H17N/c1-6-2-4-7(8)5-3-6;1-4-6-8(3)7-5-2/h2-5H,1H3;4-7H2,1-3H3.
What are the key properties of 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine?
1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine has a molecular weight of 225.35 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methylbenzene;N-methyl-N-propylpropan-1-amine is sourced from PubChem (CID 143556008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).