About 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene
1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene (PubChem CID 144561335) has the molecular formula C22H22F2
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene.
Molecular Properties
| Compound Name | 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene |
| PubChem CID | 144561335 |
| Molecular Formula | C22H22F2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene |
| SMILES | Cc1ccc(CCc2ccc(F)cc2)cc1.Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15F.C7H7F/c1-12-2-4-13(5-3-12)6-7-14-8-10-15(16)11-9-14;1-6-2-4-7(8)5-3-6/h2-5,8-11H,6-7H2,1H3;2-5H,1H3 |
| InChIKey | MFWSWVXVCIERBA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene?
The IUPAC name of 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene (CID 144561335) is 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene.
What is the SMILES notation for 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene?
The canonical SMILES for 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene is Cc1ccc(CCc2ccc(F)cc2)cc1.Cc1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene?
The InChIKey is MFWSWVXVCIERBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F.C7H7F/c1-12-2-4-13(5-3-12)6-7-14-8-10-15(16)11-9-14;1-6-2-4-7(8)5-3-6/h2-5,8-11H,6-7H2,1H3;2-5H,1H3.
What are the key properties of 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene?
1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene has a molecular weight of 324.41 g/mol, XLogP of 6.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methylbenzene;1-fluoro-4-[2-(4-methylphenyl)ethyl]benzene is sourced from PubChem (CID 144561335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).