About 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine
4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine (PubChem CID 142886824) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine |
| PubChem CID | 142886824 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine |
| SMILES | CCCN(C)CCC.Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C8H7N.C7H17N/c1-7-2-4-8(6-9)5-3-7;1-4-6-8(3)7-5-2/h2-5H,1H3;4-7H2,1-3H3 |
| InChIKey | HZTPZZIQUCBMHA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine?
The IUPAC name of 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine (CID 142886824) is 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine.
What is the SMILES notation for 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine?
The canonical SMILES for 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine is CCCN(C)CCC.Cc1ccc(C#N)cc1.
What is the InChIKey of 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine?
The InChIKey is HZTPZZIQUCBMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H17N/c1-7-2-4-8(6-9)5-3-7;1-4-6-8(3)7-5-2/h2-5H,1H3;4-7H2,1-3H3.
What are the key properties of 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine?
4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine has a molecular weight of 232.37 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzonitrile;N-methyl-N-propylpropan-1-amine is sourced from PubChem (CID 142886824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).