About ethane;4-methylbenzonitrile;4-methylideneoctane
ethane;4-methylbenzonitrile;4-methylideneoctane (PubChem CID 142349797) has the molecular formula C19H31N
and a molecular weight of 273.46 g/mol. Its IUPAC name is ethane;4-methylbenzonitrile;4-methylideneoctane.
Molecular Properties
| Compound Name | ethane;4-methylbenzonitrile;4-methylideneoctane |
| PubChem CID | 142349797 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | ethane;4-methylbenzonitrile;4-methylideneoctane |
| SMILES | C=C(CCC)CCCC.CC.Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C9H18.C8H7N.C2H6/c1-4-6-8-9(3)7-5-2;1-7-2-4-8(6-9)5-3-7;1-2/h3-8H2,1-2H3;2-5H,1H3;1-2H3 |
| InChIKey | LHWMOGBPONFQOJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methylbenzonitrile;4-methylideneoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylbenzonitrile;4-methylideneoctane?
The IUPAC name of ethane;4-methylbenzonitrile;4-methylideneoctane (CID 142349797) is ethane;4-methylbenzonitrile;4-methylideneoctane.
What is the SMILES notation for ethane;4-methylbenzonitrile;4-methylideneoctane?
The canonical SMILES for ethane;4-methylbenzonitrile;4-methylideneoctane is C=C(CCC)CCCC.CC.Cc1ccc(C#N)cc1.
What is the InChIKey of ethane;4-methylbenzonitrile;4-methylideneoctane?
The InChIKey is LHWMOGBPONFQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C8H7N.C2H6/c1-4-6-8-9(3)7-5-2;1-7-2-4-8(6-9)5-3-7;1-2/h3-8H2,1-2H3;2-5H,1H3;1-2H3.
What are the key properties of ethane;4-methylbenzonitrile;4-methylideneoctane?
ethane;4-methylbenzonitrile;4-methylideneoctane has a molecular weight of 273.46 g/mol, XLogP of 6.43, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylbenzonitrile;4-methylideneoctane is sourced from PubChem (CID 142349797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).