About 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile
4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile (PubChem CID 122403774) has the molecular formula C20H16N2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile |
| PubChem CID | 122403774 |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile |
| SMILES | C=C(CCC(=C)c1ccc(C#N)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H16N2/c1-15(19-9-5-17(13-21)6-10-19)3-4-16(2)20-11-7-18(14-22)8-12-20/h5-12H,1-4H2 |
| InChIKey | HYUMPDGSTOUGFB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile?
The IUPAC name of 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile (CID 122403774) is 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile.
What is the SMILES notation for 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile?
The canonical SMILES for 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile is C=C(CCC(=C)c1ccc(C#N)cc1)c1ccc(C#N)cc1.
What is the InChIKey of 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile?
The InChIKey is HYUMPDGSTOUGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2/c1-15(19-9-5-17(13-21)6-10-19)3-4-16(2)20-11-7-18(14-22)8-12-20/h5-12H,1-4H2.
What are the key properties of 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile?
4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile has a molecular weight of 284.36 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-cyanophenyl)hexa-1,5-dien-2-yl]benzonitrile is sourced from PubChem (CID 122403774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).