C12H4N4 — CID 121012832
2-(4-cyanophenyl)ethene-1,1,2-tricarbonitrile (PubChem CID 121012832) has the molecular formula C12H4N4 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-(4-cyanophenyl)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-cyanophenyl)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 121012832 |
| Molecular Formula | C12H4N4 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-(4-cyanophenyl)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H4N4/c13-5-9-1-3-10(4-2-9)12(8-16)11(6-14)7-15/h1-4H |
| InChIKey | OBVFRNJCETZXDQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|