About 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine
4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine (PubChem CID 143868789) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine.
Molecular Properties
| Compound Name | 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine |
| PubChem CID | 143868789 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine |
| SMILES | C=C(C)CNCCCC.Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C8H7N.C8H17N/c1-7-2-4-8(6-9)5-3-7;1-4-5-6-9-7-8(2)3/h2-5H,1H3;9H,2,4-7H2,1,3H3 |
| InChIKey | GPYWZIJHULKDQN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine?
The IUPAC name of 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine (CID 143868789) is 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine.
What is the SMILES notation for 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine?
The canonical SMILES for 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine is C=C(C)CNCCCC.Cc1ccc(C#N)cc1.
What is the InChIKey of 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine?
The InChIKey is GPYWZIJHULKDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C8H17N/c1-7-2-4-8(6-9)5-3-7;1-4-5-6-9-7-8(2)3/h2-5H,1H3;9H,2,4-7H2,1,3H3.
What are the key properties of 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine?
4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine has a molecular weight of 244.38 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzonitrile;N-(2-methylprop-2-enyl)butan-1-amine is sourced from PubChem (CID 143868789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).