About 4-heptylbenzonitrile
4-heptylbenzonitrile (PubChem CID 575863) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-heptylbenzonitrile.
Molecular Properties
| Compound Name | 4-heptylbenzonitrile |
| PubChem CID | 575863 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-heptylbenzonitrile |
| SMILES | CCCCCCCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N/c1-2-3-4-5-6-7-13-8-10-14(12-15)11-9-13/h8-11H,2-7H2,1H3 |
| InChIKey | XTIKBCXMOYZUMG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptylbenzonitrile?
The IUPAC name of 4-heptylbenzonitrile (CID 575863) is 4-heptylbenzonitrile.
What is the SMILES notation for 4-heptylbenzonitrile?
The canonical SMILES for 4-heptylbenzonitrile is CCCCCCCc1ccc(C#N)cc1.
What is the InChIKey of 4-heptylbenzonitrile?
The InChIKey is XTIKBCXMOYZUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-3-4-5-6-7-13-8-10-14(12-15)11-9-13/h8-11H,2-7H2,1H3.
What are the key properties of 4-heptylbenzonitrile?
4-heptylbenzonitrile has a molecular weight of 201.31 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptylbenzonitrile is sourced from PubChem (CID 575863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).