C19H21N — CID 71129166
4-[(2S,4R)-4-(4-methylphenyl)pentan-2-yl]benzonitrile (PubChem CID 71129166) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-[(2S,4R)-4-(4-methylphenyl)pentan-2-yl]benzonitrile.
| Compound Name | 4-[(2S,4R)-4-(4-methylphenyl)pentan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 71129166 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-[(2S,4R)-4-(4-methylphenyl)pentan-2-yl]benzonitrile |
| SMILES | Cc1ccc([C@H](C)C[C@H](C)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H21N/c1-14-4-8-18(9-5-14)15(2)12-16(3)19-10-6-17(13-20)7-11-19/h4-11,15-16H,12H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | NFQGTBUWFYETBE-CVEARBPZSA-N |
| XLogP | 5.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |