C12H19N — CID 11789769
(2S,4R)-4-(4-methylphenyl)pentan-2-amine (PubChem CID 11789769) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2S,4R)-4-(4-methylphenyl)pentan-2-amine.
| Compound Name | (2S,4R)-4-(4-methylphenyl)pentan-2-amine |
|---|---|
| PubChem CID | 11789769 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2S,4R)-4-(4-methylphenyl)pentan-2-amine |
| SMILES | Cc1ccc([C@H](C)C[C@H](C)N)cc1 |
| InChI | InChI=1S/C12H19N/c1-9-4-6-12(7-5-9)10(2)8-11(3)13/h4-7,10-11H,8,13H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | KMTNADUHSNQQQM-MNOVXSKESA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |