C28H34 — CID 164713773
1-[4,6-bis(4-methylphenyl)heptan-2-yl]-4-methylbenzene (PubChem CID 164713773) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is 1-[4,6-bis(4-methylphenyl)heptan-2-yl]-4-methylbenzene.
| Compound Name | 1-[4,6-bis(4-methylphenyl)heptan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 164713773 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-[4,6-bis(4-methylphenyl)heptan-2-yl]-4-methylbenzene |
| SMILES | Cc1ccc(C(C)CC(CC(C)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H34/c1-20-6-12-25(13-7-20)23(4)18-28(27-16-10-22(3)11-17-27)19-24(5)26-14-8-21(2)9-15-26/h6-17,23-24,28H,18-19H2,1-5H3 |
| InChIKey | OWWDKESIGJJIMN-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |