C34H42N4 — CID 134463641
4-[4,6,8-tris(4-aminophenyl)decan-2-yl]aniline (PubChem CID 134463641) has the molecular formula C34H42N4 and a molecular weight of 506.74 g/mol. Its IUPAC name is 4-[4,6,8-tris(4-aminophenyl)decan-2-yl]aniline.
| Compound Name | 4-[4,6,8-tris(4-aminophenyl)decan-2-yl]aniline |
|---|---|
| PubChem CID | 134463641 |
| Molecular Formula | C34H42N4 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 4-[4,6,8-tris(4-aminophenyl)decan-2-yl]aniline |
| SMILES | CCC(CC(CC(CC(C)c1ccc(N)cc1)c1ccc(N)cc1)c1ccc(N)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C34H42N4/c1-3-24(26-6-14-32(36)15-7-26)21-30(28-10-18-34(38)19-11-28)22-29(27-8-16-33(37)17-9-27)20-23(2)25-4-12-31(35)13-5-25/h4-19,23-24,29-30H,3,20-22,35-38H2,1-2H3 |
| InChIKey | NWAXGLGBNKSAMV-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|