C26H28MgO6S2 — CID 172972808
magnesium 4-[6-phenyl-4-(4-sulfonatophenyl)octan-2-yl]benzenesulfonate (PubChem CID 172972808) has the molecular formula C26H28MgO6S2 and a molecular weight of 524.94 g/mol. Its IUPAC name is magnesium 4-[6-phenyl-4-(4-sulfonatophenyl)octan-2-yl]benzenesulfonate.
| Compound Name | magnesium 4-[6-phenyl-4-(4-sulfonatophenyl)octan-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 172972808 |
| Molecular Formula | C26H28MgO6S2 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | magnesium 4-[6-phenyl-4-(4-sulfonatophenyl)octan-2-yl]benzenesulfonate |
| SMILES | CCC(CC(CC(C)c1ccc(S(=O)(=O)[O-])cc1)c1ccc(S(=O)(=O)[O-])cc1)c1ccccc1.[Mg+2] |
| InChI | InChI=1S/C26H30O6S2.Mg/c1-3-20(22-7-5-4-6-8-22)18-24(23-11-15-26(16-12-23)34(30,31)32)17-19(2)21-9-13-25(14-10-21)33(27,28)29;/h4-16,19-20,24H,3,17-18H2,1-2H3,(H,27,28,29)(H,30,31,32);/q;+2/p-2 |
| InChIKey | UKZMQQOLRFGQPI-UHFFFAOYSA-L |
| XLogP | 4.98 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|