C10H13O3S- — CID 140600971
4-[(2R)-butan-2-yl]benzenesulfonate (PubChem CID 140600971) has the molecular formula C10H13O3S- and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-[(2R)-butan-2-yl]benzenesulfonate.
| Compound Name | 4-[(2R)-butan-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 140600971 |
| Molecular Formula | C10H13O3S- |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-[(2R)-butan-2-yl]benzenesulfonate |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H14O3S/c1-3-8(2)9-4-6-10(7-5-9)14(11,12)13/h4-8H,3H2,1-2H3,(H,11,12,13)/p-1/t8-/m1/s1 |
| InChIKey | OVXNLJHNNUAEMR-MRVPVSSYSA-M |
| XLogP | 2.10 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|