C14H21O3S- — CID 20767325
4-(5,5-dimethylhexan-2-yl)benzenesulfonate (PubChem CID 20767325) has the molecular formula C14H21O3S- and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-(5,5-dimethylhexan-2-yl)benzenesulfonate.
| Compound Name | 4-(5,5-dimethylhexan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 20767325 |
| Molecular Formula | C14H21O3S- |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(5,5-dimethylhexan-2-yl)benzenesulfonate |
| SMILES | CC(CCC(C)(C)C)c1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H22O3S/c1-11(9-10-14(2,3)4)12-5-7-13(8-6-12)18(15,16)17/h5-8,11H,9-10H2,1-4H3,(H,15,16,17)/p-1 |
| InChIKey | YWHUDCSUSXOGCY-UHFFFAOYSA-M |
| XLogP | 3.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|